C17H23FN2O2S2 — CID 9150694
5-[(3R)-dithiolan-3-yl]-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylpentanamide (PubChem CID 9150694) has the molecular formula C17H23FN2O2S2 and a molecular weight of 370.52 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylpentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylpentanamide |
|---|---|
| PubChem CID | 9150694 |
| Molecular Formula | C17H23FN2O2S2 |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylpentanamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C17H23FN2O2S2/c1-20(12-16(21)19-14-6-4-5-13(18)11-14)17(22)8-3-2-7-15-9-10-23-24-15/h4-6,11,15H,2-3,7-10,12H2,1H3,(H,19,21)/t15-/m1/s1 |
| InChIKey | RDPSWOGANRVJDA-OAHLLOKOSA-N |
| XLogP | 3.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|