C21H24N2O2S2 — CID 60517095
N-[3-[5-(dithiolan-3-yl)pentanoylamino]phenyl]benzamide (PubChem CID 60517095) has the molecular formula C21H24N2O2S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-[3-[5-(dithiolan-3-yl)pentanoylamino]phenyl]benzamide.
| Compound Name | N-[3-[5-(dithiolan-3-yl)pentanoylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 60517095 |
| Molecular Formula | C21H24N2O2S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[3-[5-(dithiolan-3-yl)pentanoylamino]phenyl]benzamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1cccc(NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H24N2O2S2/c24-20(12-5-4-11-19-13-14-26-27-19)22-17-9-6-10-18(15-17)23-21(25)16-7-2-1-3-8-16/h1-3,6-10,15,19H,4-5,11-14H2,(H,22,24)(H,23,25) |
| InChIKey | NKMGBBOKNCDDPN-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|