C16H19N3O2S2 — CID 135639539
5-(dithiolan-3-yl)-N-(4-oxo-3H-quinazolin-6-yl)pentanamide (PubChem CID 135639539) has the molecular formula C16H19N3O2S2 and a molecular weight of 349.48 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-(4-oxo-3H-quinazolin-6-yl)pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-(4-oxo-3H-quinazolin-6-yl)pentanamide |
|---|---|
| PubChem CID | 135639539 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-(4-oxo-3H-quinazolin-6-yl)pentanamide |
| SMILES | O=C(CCCCC1CCSS1)Nc1ccc2nc[nH]c(=O)c2c1 |
| InChI | InChI=1S/C16H19N3O2S2/c20-15(4-2-1-3-12-7-8-22-23-12)19-11-5-6-14-13(9-11)16(21)18-10-17-14/h5-6,9-10,12H,1-4,7-8H2,(H,19,20)(H,17,18,21) |
| InChIKey | UMXAFDFDTMSYAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|