C32H54N4O8S3 — CID 158525602
4-[2-[2-[[(3S)-7-[5-(dithiolan-3-yl)pentanoylamino]-4-oxo-3-[5-(thiolan-2-yl)pentanoylamino]heptanoyl]amino]ethoxy]ethylamino]-4-oxobutanoic acid (PubChem CID 158525602) has the molecular formula C32H54N4O8S3 and a molecular weight of 719.00 g/mol. Its IUPAC name is 4-[2-[2-[[(3S)-7-[5-(dithiolan-3-yl)pentanoylamino]-4-oxo-3-[5-(thiolan-2-yl)pentanoylamino]heptanoyl]amino]ethoxy]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-[[(3S)-7-[5-(dithiolan-3-yl)pentanoylamino]-4-oxo-3-[5-(thiolan-2-yl)pentanoylamino]heptanoyl]amino]ethoxy]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 158525602 |
| Molecular Formula | C32H54N4O8S3 |
| Molecular Weight | 719.00 g/mol |
| Exact Mass | 718.31 |
| IUPAC Name | 4-[2-[2-[[(3S)-7-[5-(dithiolan-3-yl)pentanoylamino]-4-oxo-3-[5-(thiolan-2-yl)pentanoylamino]heptanoyl]amino]ethoxy]ethylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)NCCOCCNC(=O)C[C@H](NC(=O)CCCCC1CCCS1)C(=O)CCCNC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C32H54N4O8S3/c37-27(10-5-16-33-28(38)11-3-2-8-25-15-22-46-47-25)26(36-30(40)12-4-1-7-24-9-6-21-45-24)23-31(41)35-18-20-44-19-17-34-29(39)13-14-32(42)43/h24-26H,1-23H2,(H,33,38)(H,34,39)(H,35,41)(H,36,40)(H,42,43)/t24?,25?,26-/m0/s1 |
| InChIKey | HMTBMZHDEWCXAW-WNMGUVTHSA-N |
| XLogP | 3.61 |
| TPSA | 180.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.00 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|