C18H29NO5S2 — CID 76762473
4-[5-(dithiolan-3-yl)pentanoylamino]-7-methyl-5,8-dioxononanoic acid (PubChem CID 76762473) has the molecular formula C18H29NO5S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 4-[5-(dithiolan-3-yl)pentanoylamino]-7-methyl-5,8-dioxononanoic acid.
| Compound Name | 4-[5-(dithiolan-3-yl)pentanoylamino]-7-methyl-5,8-dioxononanoic acid |
|---|---|
| PubChem CID | 76762473 |
| Molecular Formula | C18H29NO5S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 4-[5-(dithiolan-3-yl)pentanoylamino]-7-methyl-5,8-dioxononanoic acid |
| SMILES | CC(=O)C(C)CC(=O)C(CCC(=O)O)NC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C18H29NO5S2/c1-12(13(2)20)11-16(21)15(7-8-18(23)24)19-17(22)6-4-3-5-14-9-10-25-26-14/h12,14-15H,3-11H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | HPODVVYRFVFJCD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|