C13H23NO3S3 — CID 101071287
(2R)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylsulfanylbutanoic acid (PubChem CID 101071287) has the molecular formula C13H23NO3S3 and a molecular weight of 337.53 g/mol. Its IUPAC name is (2R)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 101071287 |
| Molecular Formula | C13H23NO3S3 |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2R)-2-[5-(dithiolan-3-yl)pentanoylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@@H](NC(=O)CCCCC1CCSS1)C(=O)O |
| InChI | InChI=1S/C13H23NO3S3/c1-18-8-7-11(13(16)17)14-12(15)5-3-2-4-10-6-9-19-20-10/h10-11H,2-9H2,1H3,(H,14,15)(H,16,17)/t10?,11-/m1/s1 |
| InChIKey | FFMXBKIVHPZABY-RRKGBCIJSA-N |
| XLogP | 3.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|