C14H25N5O5S2 — CID 18346210
(2S)-5-[[amino(nitramido)methylidene]amino]-2-[5-(dithiolan-3-yl)pentanoylamino]pentanoic acid (PubChem CID 18346210) has the molecular formula C14H25N5O5S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is (2S)-5-[[amino(nitramido)methylidene]amino]-2-[5-(dithiolan-3-yl)pentanoylamino]pentanoic acid.
| Compound Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[5-(dithiolan-3-yl)pentanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 18346210 |
| Molecular Formula | C14H25N5O5S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (2S)-5-[[amino(nitramido)methylidene]amino]-2-[5-(dithiolan-3-yl)pentanoylamino]pentanoic acid |
| SMILES | N/C(=N\CCC[C@H](NC(=O)CCCCC1CCSS1)C(=O)O)N[N+](=O)[O-] |
| InChI | InChI=1S/C14H25N5O5S2/c15-14(18-19(23)24)16-8-3-5-11(13(21)22)17-12(20)6-2-1-4-10-7-9-25-26-10/h10-11H,1-9H2,(H,17,20)(H,21,22)(H3,15,16,18)/t10?,11-/m0/s1 |
| InChIKey | ZDFDIAXFFBZFGN-DTIOYNMSSA-N |
| XLogP | 1.15 |
| TPSA | 159.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|