C12H20IrNO3S3- — CID 156715170
2-[5-(dithiolan-3-yl)pentanoylamino]-3-methoxy-3-oxopropane-1-thiolate;iridium (PubChem CID 156715170) has the molecular formula C12H20IrNO3S3- and a molecular weight of 514.71 g/mol. Its IUPAC name is 2-[5-(dithiolan-3-yl)pentanoylamino]-3-methoxy-3-oxopropane-1-thiolate;iridium.
| Compound Name | 2-[5-(dithiolan-3-yl)pentanoylamino]-3-methoxy-3-oxopropane-1-thiolate;iridium |
|---|---|
| PubChem CID | 156715170 |
| Molecular Formula | C12H20IrNO3S3- |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | 2-[5-(dithiolan-3-yl)pentanoylamino]-3-methoxy-3-oxopropane-1-thiolate;iridium |
| SMILES | COC(=O)C(C[S-])NC(=O)CCCCC1CCSS1.[Ir] |
| InChI | InChI=1S/C12H21NO3S3.Ir/c1-16-12(15)10(8-17)13-11(14)5-3-2-4-9-6-7-18-19-9;/h9-10,17H,2-8H2,1H3,(H,13,14);/p-1 |
| InChIKey | UNIQZYFKBASONI-UHFFFAOYSA-M |
| XLogP | 1.90 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|