C16H26N2O6S2 — CID 130277525
2-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]propanoyl]amino]pentanedioic acid (PubChem CID 130277525) has the molecular formula C16H26N2O6S2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]propanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]propanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 130277525 |
| Molecular Formula | C16H26N2O6S2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 2-[[(2S)-2-[5-(dithiolan-3-yl)pentanoylamino]propanoyl]amino]pentanedioic acid |
| SMILES | C[C@H](NC(=O)CCCCC1CCSS1)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H26N2O6S2/c1-10(15(22)18-12(16(23)24)6-7-14(20)21)17-13(19)5-3-2-4-11-8-9-25-26-11/h10-12H,2-9H2,1H3,(H,17,19)(H,18,22)(H,20,21)(H,23,24)/t10-,11?,12?/m0/s1 |
| InChIKey | BIUFRRZRABDWQX-UNXYVOJBSA-N |
| XLogP | 1.64 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|