C19H30N2O6S2 — CID 123793727
6-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-2-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid (PubChem CID 123793727) has the molecular formula C19H30N2O6S2 and a molecular weight of 446.59 g/mol. Its IUPAC name is 6-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-2-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid.
| Compound Name | 6-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-2-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 123793727 |
| Molecular Formula | C19H30N2O6S2 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | 6-[5-[(3R)-dithiolan-3-yl]pentanoylamino]-2-[(4-methoxy-4-oxobut-2-enoyl)amino]hexanoic acid |
| SMILES | COC(=O)C=CC(=O)NC(CCCCNC(=O)CCCC[C@@H]1CCSS1)C(=O)O |
| InChI | InChI=1S/C19H30N2O6S2/c1-27-18(24)10-9-17(23)21-15(19(25)26)7-4-5-12-20-16(22)8-3-2-6-14-11-13-28-29-14/h9-10,14-15H,2-8,11-13H2,1H3,(H,20,22)(H,21,23)(H,25,26)/t14-,15?/m1/s1 |
| InChIKey | LMLYJBBEOUCANG-GICMACPYSA-N |
| XLogP | 2.29 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|