About 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate
2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate (PubChem CID 168800404) has the molecular formula C11H20O3S2
and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate.
Molecular Properties
| Compound Name | 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate |
| PubChem CID | 168800404 |
| Molecular Formula | C11H20O3S2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate |
| SMILES | CC(O)COC(=O)CCCCC1CCSS1 |
| InChI | InChI=1S/C11H20O3S2/c1-9(12)8-14-11(13)5-3-2-4-10-6-7-15-16-10/h9-10,12H,2-8H2,1H3 |
| InChIKey | TZZXESSVCBOSNI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate?
The IUPAC name of 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate (CID 168800404) is 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate.
What is the SMILES notation for 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate?
The canonical SMILES for 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate is CC(O)COC(=O)CCCCC1CCSS1.
What is the InChIKey of 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate?
The InChIKey is TZZXESSVCBOSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3S2/c1-9(12)8-14-11(13)5-3-2-4-10-6-7-15-16-10/h9-10,12H,2-8H2,1H3.
What are the key properties of 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate?
2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate has a molecular weight of 264.41 g/mol, XLogP of 2.62, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropyl 5-(dithiolan-3-yl)pentanoate is sourced from PubChem (CID 168800404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).