About 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate
4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate (PubChem CID 170157540) has the molecular formula C18H30O6S2
and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate |
| PubChem CID | 170157540 |
| Molecular Formula | C18H30O6S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(=O)OCCOC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C18H30O6S2/c1-18(2,3)24-17(21)9-8-16(20)23-12-11-22-15(19)7-5-4-6-14-10-13-25-26-14/h14H,4-13H2,1-3H3/t14-/m1/s1 |
| InChIKey | GQYVNBZPMJFVQQ-CQSZACIVSA-N |
| XLogP | 3.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate (CID 170157540) is 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate is CC(C)(C)OC(=O)CCC(=O)OCCOC(=O)CCCC[C@@H]1CCSS1.
What is the InChIKey of 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate?
The InChIKey is GQYVNBZPMJFVQQ-CQSZACIVSA-N. The full InChI is InChI=1S/C18H30O6S2/c1-18(2,3)24-17(21)9-8-16(20)23-12-11-22-15(19)7-5-4-6-14-10-13-25-26-14/h14H,4-13H2,1-3H3/t14-/m1/s1.
What are the key properties of 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate?
4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate has a molecular weight of 406.57 g/mol, XLogP of 3.91, 11 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-[2-[5-[(3R)-dithiolan-3-yl]pentanoyloxy]ethyl] butanedioate is sourced from PubChem (CID 170157540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).