C27H44O6S6 — CID 101202834
2,2-bis[4-(dithiolan-3-yl)butanoyloxymethyl]butyl 4-(dithiolan-3-yl)butanoate (PubChem CID 101202834) has the molecular formula C27H44O6S6 and a molecular weight of 657.04 g/mol. Its IUPAC name is 2,2-bis[4-(dithiolan-3-yl)butanoyloxymethyl]butyl 4-(dithiolan-3-yl)butanoate.
| Compound Name | 2,2-bis[4-(dithiolan-3-yl)butanoyloxymethyl]butyl 4-(dithiolan-3-yl)butanoate |
|---|---|
| PubChem CID | 101202834 |
| Molecular Formula | C27H44O6S6 |
| Molecular Weight | 657.04 g/mol |
| Exact Mass | 656.15 |
| IUPAC Name | 2,2-bis[4-(dithiolan-3-yl)butanoyloxymethyl]butyl 4-(dithiolan-3-yl)butanoate |
| SMILES | CCC(COC(=O)CCCC1CCSS1)(COC(=O)CCCC1CCSS1)COC(=O)CCCC1CCSS1 |
| InChI | InChI=1S/C27H44O6S6/c1-2-27(18-31-24(28)9-3-6-21-12-15-34-37-21,19-32-25(29)10-4-7-22-13-16-35-38-22)20-33-26(30)11-5-8-23-14-17-36-39-23/h21-23H,2-20H2,1H3 |
| InChIKey | JDGMQKCGJJTMOC-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.04 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|