About [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate
[2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate (PubChem CID 143831454) has the molecular formula C22H40O4S4
and a molecular weight of 496.83 g/mol. Its IUPAC name is [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate.
Molecular Properties
| Compound Name | [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate |
| PubChem CID | 143831454 |
| Molecular Formula | C22H40O4S4 |
| Molecular Weight | 496.83 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate |
| SMILES | CCC(CCCCC(=O)OCC(C)(CC)COC(=O)CCCCC1CCSS1)SS |
| InChI | InChI=1S/C22H40O4S4/c1-4-18(29-27)10-6-8-12-20(23)25-16-22(3,5-2)17-26-21(24)13-9-7-11-19-14-15-28-30-19/h18-19,27H,4-17H2,1-3H3 |
| InChIKey | OEEOAQCPTDSBME-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate?
The IUPAC name of [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate (CID 143831454) is [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate.
What is the SMILES notation for [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate?
The canonical SMILES for [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate is CCC(CCCCC(=O)OCC(C)(CC)COC(=O)CCCCC1CCSS1)SS.
What is the InChIKey of [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate?
The InChIKey is OEEOAQCPTDSBME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H40O4S4/c1-4-18(29-27)10-6-8-12-20(23)25-16-22(3,5-2)17-26-21(24)13-9-7-11-19-14-15-28-30-19/h18-19,27H,4-17H2,1-3H3.
What are the key properties of [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate?
[2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate has a molecular weight of 496.83 g/mol, XLogP of 7.12, 17 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[5-(dithiolan-3-yl)pentanoyloxymethyl]-2-methylbutyl] 6-(disulfanyl)octanoate is sourced from PubChem (CID 143831454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).