C25H38N4O2S2 — CID 173472636
5-[(3R)-dithiolan-3-yl]-N-[2-[4-[6-(2-pyrrolidin-1-ylethyl)-3-pyridinyl]but-3-enoylamino]ethyl]pentanamide (PubChem CID 173472636) has the molecular formula C25H38N4O2S2 and a molecular weight of 490.74 g/mol. Its IUPAC name is 5-[(3R)-dithiolan-3-yl]-N-[2-[4-[6-(2-pyrrolidin-1-ylethyl)-3-pyridinyl]but-3-enoylamino]ethyl]pentanamide.
| Compound Name | 5-[(3R)-dithiolan-3-yl]-N-[2-[4-[6-(2-pyrrolidin-1-ylethyl)-3-pyridinyl]but-3-enoylamino]ethyl]pentanamide |
|---|---|
| PubChem CID | 173472636 |
| Molecular Formula | C25H38N4O2S2 |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 5-[(3R)-dithiolan-3-yl]-N-[2-[4-[6-(2-pyrrolidin-1-ylethyl)-3-pyridinyl]but-3-enoylamino]ethyl]pentanamide |
| SMILES | O=C(CC=Cc1ccc(CCN2CCCC2)nc1)NCCNC(=O)CCCC[C@@H]1CCSS1 |
| InChI | InChI=1S/C25H38N4O2S2/c30-24(8-2-1-7-23-13-19-32-33-23)26-14-15-27-25(31)9-5-6-21-10-11-22(28-20-21)12-18-29-16-3-4-17-29/h5-6,10-11,20,23H,1-4,7-9,12-19H2,(H,26,30)(H,27,31)/t23-/m1/s1 |
| InChIKey | PBWZBLJQDMABMN-HSZRJFAPSA-N |
| XLogP | 4.07 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|