C36H67N5O7S2 — CID 102460383
tert-butyl 2-[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-7,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 102460383) has the molecular formula C36H67N5O7S2 and a molecular weight of 746.09 g/mol. Its IUPAC name is tert-butyl 2-[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-7,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-7,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 102460383 |
| Molecular Formula | C36H67N5O7S2 |
| Molecular Weight | 746.09 g/mol |
| Exact Mass | 745.45 |
| IUPAC Name | tert-butyl 2-[4-[2-[5-(dithiolan-3-yl)pentanoylamino]ethyl]-7,10-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CCNC(=O)CCCCC2CCSS2)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C36H67N5O7S2/c1-34(2,3)46-31(43)26-39-19-17-38(16-15-37-30(42)13-11-10-12-29-14-25-49-50-29)18-20-40(27-32(44)47-35(4,5)6)22-24-41(23-21-39)28-33(45)48-36(7,8)9/h29H,10-28H2,1-9H3,(H,37,42) |
| InChIKey | JAUQKDYCLXLXQT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 120.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.09 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|