C18H34N2O3S2 — CID 144696750
5-(dithiolan-3-yl)-N-[3-methyl-3-(3-methyl-3-nitrosobutoxy)butyl]pentanamide (PubChem CID 144696750) has the molecular formula C18H34N2O3S2 and a molecular weight of 390.62 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[3-methyl-3-(3-methyl-3-nitrosobutoxy)butyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[3-methyl-3-(3-methyl-3-nitrosobutoxy)butyl]pentanamide |
|---|---|
| PubChem CID | 144696750 |
| Molecular Formula | C18H34N2O3S2 |
| Molecular Weight | 390.62 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[3-methyl-3-(3-methyl-3-nitrosobutoxy)butyl]pentanamide |
| SMILES | CC(C)(CCOC(C)(C)CCNC(=O)CCCCC1CCSS1)N=O |
| InChI | InChI=1S/C18H34N2O3S2/c1-17(2,20-22)11-13-23-18(3,4)10-12-19-16(21)8-6-5-7-15-9-14-24-25-15/h15H,5-14H2,1-4H3,(H,19,21) |
| InChIKey | SPMBWSMPYHLFKP-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|