C38H68N6O12 — CID 59492064
(2S)-2-[6-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoylamino]butanedioic acid (PubChem CID 59492064) has the molecular formula C38H68N6O12 and a molecular weight of 800.99 g/mol. Its IUPAC name is (2S)-2-[6-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoylamino]butanedioic acid.
| Compound Name | (2S)-2-[6-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 59492064 |
| Molecular Formula | C38H68N6O12 |
| Molecular Weight | 800.99 g/mol |
| Exact Mass | 800.49 |
| IUPAC Name | (2S)-2-[6-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoylamino]butanedioic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)NCCCCCC(=O)N[C@@H](CC(=O)O)C(=O)O)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C38H68N6O12/c1-36(2,3)54-32(49)25-42-17-15-41(24-30(46)39-14-12-10-11-13-29(45)40-28(35(52)53)23-31(47)48)16-18-43(26-33(50)55-37(4,5)6)20-22-44(21-19-42)27-34(51)56-38(7,8)9/h28H,10-27H2,1-9H3,(H,39,46)(H,40,45)(H,47,48)(H,52,53)/t28-/m0/s1 |
| InChIKey | SJWUHYKRCFVDHQ-NDEPHWFRSA-N |
| XLogP | 0.95 |
| TPSA | 224.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.99 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|