C33H63N7O11S — CID 122581334
(2R)-3-(2-aminoethylamino)-3-oxo-2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propane-1-sulfonic acid (PubChem CID 122581334) has the molecular formula C33H63N7O11S and a molecular weight of 765.97 g/mol. Its IUPAC name is (2R)-3-(2-aminoethylamino)-3-oxo-2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propane-1-sulfonic acid.
| Compound Name | (2R)-3-(2-aminoethylamino)-3-oxo-2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 122581334 |
| Molecular Formula | C33H63N7O11S |
| Molecular Weight | 765.97 g/mol |
| Exact Mass | 765.43 |
| IUPAC Name | (2R)-3-(2-aminoethylamino)-3-oxo-2-[[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]propane-1-sulfonic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)N[C@@H](CS(=O)(=O)O)C(=O)NCCN)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C33H63N7O11S/c1-31(2,3)49-27(42)21-38-14-12-37(20-26(41)36-25(24-52(46,47)48)30(45)35-11-10-34)13-15-39(22-28(43)50-32(4,5)6)17-19-40(18-16-38)23-29(44)51-33(7,8)9/h25H,10-24,34H2,1-9H3,(H,35,45)(H,36,41)(H,46,47,48)/t25-/m0/s1 |
| InChIKey | ZQZLNMNWFCRXNU-VWLOTQADSA-N |
| XLogP | -1.32 |
| TPSA | 230.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.97 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|