C37H62N6O11 — CID 166487724
tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[2-oxo-2-[2-[(3,4,5-trihydroxybenzoyl)amino]ethylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 166487724) has the molecular formula C37H62N6O11 and a molecular weight of 766.93 g/mol. Its IUPAC name is tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[2-oxo-2-[2-[(3,4,5-trihydroxybenzoyl)amino]ethylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[2-oxo-2-[2-[(3,4,5-trihydroxybenzoyl)amino]ethylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 166487724 |
| Molecular Formula | C37H62N6O11 |
| Molecular Weight | 766.93 g/mol |
| Exact Mass | 766.45 |
| IUPAC Name | tert-butyl 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-10-[2-oxo-2-[2-[(3,4,5-trihydroxybenzoyl)amino]ethylamino]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)NCCNC(=O)c2cc(O)c(O)c(O)c2)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C37H62N6O11/c1-35(2,3)52-30(47)23-41-14-12-40(22-29(46)38-10-11-39-34(51)26-20-27(44)33(50)28(45)21-26)13-15-42(24-31(48)53-36(4,5)6)17-19-43(18-16-41)25-32(49)54-37(7,8)9/h20-21,44-45,50H,10-19,22-25H2,1-9H3,(H,38,46)(H,39,51) |
| InChIKey | VYWVNFSMJDYTBS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 210.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.93 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|