C19H32N6O4 — CID 175826968
3,4-dihydroxy-N-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]benzamide (PubChem CID 175826968) has the molecular formula C19H32N6O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 3,4-dihydroxy-N-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dihydroxy-N-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 175826968 |
| Molecular Formula | C19H32N6O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 3,4-dihydroxy-N-[2-[[2-(1,4,7,10-tetrazacyclododec-1-yl)acetyl]amino]ethyl]benzamide |
| SMILES | O=C(CN1CCNCCNCCNCC1)NCCNC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C19H32N6O4/c26-16-2-1-15(13-17(16)27)19(29)24-8-7-23-18(28)14-25-11-9-21-5-3-20-4-6-22-10-12-25/h1-2,13,20-22,26-27H,3-12,14H2,(H,23,28)(H,24,29) |
| InChIKey | XFXIHAAQLRDEKC-UHFFFAOYSA-N |
| XLogP | -1.97 |
| TPSA | 137.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|