C14H20N2O4 — CID 107728729
3,4-dihydroxy-N-(2-piperidin-4-yloxyethyl)benzamide (PubChem CID 107728729) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 3,4-dihydroxy-N-(2-piperidin-4-yloxyethyl)benzamide.
| Compound Name | 3,4-dihydroxy-N-(2-piperidin-4-yloxyethyl)benzamide |
|---|---|
| PubChem CID | 107728729 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 3,4-dihydroxy-N-(2-piperidin-4-yloxyethyl)benzamide |
| SMILES | O=C(NCCOC1CCNCC1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H20N2O4/c17-12-2-1-10(9-13(12)18)14(19)16-7-8-20-11-3-5-15-6-4-11/h1-2,9,11,15,17-18H,3-8H2,(H,16,19) |
| InChIKey | HBVZBHVVAJGVJB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|