C32H64N6O4 — CID 126492925
tert-butyl 2-[4,7-bis(2,2-dimethylpropyl)-10-[2-[2-(2-methylpropanoylamino)ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 126492925) has the molecular formula C32H64N6O4 and a molecular weight of 596.90 g/mol. Its IUPAC name is tert-butyl 2-[4,7-bis(2,2-dimethylpropyl)-10-[2-[2-(2-methylpropanoylamino)ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[4,7-bis(2,2-dimethylpropyl)-10-[2-[2-(2-methylpropanoylamino)ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 126492925 |
| Molecular Formula | C32H64N6O4 |
| Molecular Weight | 596.90 g/mol |
| Exact Mass | 596.50 |
| IUPAC Name | tert-butyl 2-[4,7-bis(2,2-dimethylpropyl)-10-[2-[2-(2-methylpropanoylamino)ethylamino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)C(=O)NCCNC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(CC(C)(C)C)CCN(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C32H64N6O4/c1-26(2)29(41)34-13-12-33-27(39)22-35-14-15-36(23-28(40)42-32(9,10)11)17-19-38(25-31(6,7)8)21-20-37(18-16-35)24-30(3,4)5/h26H,12-25H2,1-11H3,(H,33,39)(H,34,41) |
| InChIKey | UOQUYDHFCMJVBK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.90 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|