C31H58N6O9 — CID 70138090
(2S)-6-amino-2-[[2-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid (PubChem CID 70138090) has the molecular formula C31H58N6O9 and a molecular weight of 658.84 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 70138090 |
| Molecular Formula | C31H58N6O9 |
| Molecular Weight | 658.84 g/mol |
| Exact Mass | 658.43 |
| IUPAC Name | (2S)-6-amino-2-[[2-[4,7,10-tris[(2-methylpropan-2-yl)oxycarbonyl]-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(=O)N[C@@H](CCCCN)C(=O)O)CCN(C(=O)OC(C)(C)C)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C31H58N6O9/c1-29(2,3)44-26(41)35-16-14-34(22-24(38)33-23(25(39)40)12-10-11-13-32)15-17-36(27(42)45-30(4,5)6)19-21-37(20-18-35)28(43)46-31(7,8)9/h23H,10-22,32H2,1-9H3,(H,33,38)(H,39,40)/t23-/m0/s1 |
| InChIKey | ZKAKNNMNYLJTTF-QHCPKHFHSA-N |
| XLogP | 2.71 |
| TPSA | 184.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|