C22H44N4O3 — CID 58753529
tert-butyl 4-[6-amino-2-(2,4-dimethylpentan-3-ylamino)hexanoyl]piperazine-1-carboxylate (PubChem CID 58753529) has the molecular formula C22H44N4O3 and a molecular weight of 412.62 g/mol. Its IUPAC name is tert-butyl 4-[6-amino-2-(2,4-dimethylpentan-3-ylamino)hexanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-amino-2-(2,4-dimethylpentan-3-ylamino)hexanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58753529 |
| Molecular Formula | C22H44N4O3 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | tert-butyl 4-[6-amino-2-(2,4-dimethylpentan-3-ylamino)hexanoyl]piperazine-1-carboxylate |
| SMILES | CC(C)C(NC(CCCCN)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1)C(C)C |
| InChI | InChI=1S/C22H44N4O3/c1-16(2)19(17(3)4)24-18(10-8-9-11-23)20(27)25-12-14-26(15-13-25)21(28)29-22(5,6)7/h16-19,24H,8-15,23H2,1-7H3 |
| InChIKey | BAEIHYOSULFIOE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|