C16H29N3O4S — CID 54469285
tert-butyl 4-[(2S)-2-acetamido-4-methylsulfanylbutanoyl]piperazine-1-carboxylate (PubChem CID 54469285) has the molecular formula C16H29N3O4S and a molecular weight of 359.49 g/mol. Its IUPAC name is tert-butyl 4-[(2S)-2-acetamido-4-methylsulfanylbutanoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2S)-2-acetamido-4-methylsulfanylbutanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 54469285 |
| Molecular Formula | C16H29N3O4S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | tert-butyl 4-[(2S)-2-acetamido-4-methylsulfanylbutanoyl]piperazine-1-carboxylate |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)N1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H29N3O4S/c1-12(20)17-13(6-11-24-5)14(21)18-7-9-19(10-8-18)15(22)23-16(2,3)4/h13H,6-11H2,1-5H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | XHDQGCCLPCCDHY-ZDUSSCGKSA-N |
| XLogP | 1.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |