C19H33N3O4 — CID 145446627
tert-butyl 4-(2-acetamido-2-cyclohexylacetyl)piperazine-1-carboxylate (PubChem CID 145446627) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl 4-(2-acetamido-2-cyclohexylacetyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-acetamido-2-cyclohexylacetyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 145446627 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl 4-(2-acetamido-2-cyclohexylacetyl)piperazine-1-carboxylate |
| SMILES | CC(=O)NC(C(=O)N1CCN(C(=O)OC(C)(C)C)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H33N3O4/c1-14(23)20-16(15-8-6-5-7-9-15)17(24)21-10-12-22(13-11-21)18(25)26-19(2,3)4/h15-16H,5-13H2,1-4H3,(H,20,23) |
| InChIKey | KPSGLMXYROABMR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |