C11H21N3O2S — CID 60634739
(4-methylsulfanyl-1-oxo-1-piperidin-1-ylbutan-2-yl)urea (PubChem CID 60634739) has the molecular formula C11H21N3O2S and a molecular weight of 259.37 g/mol. Its IUPAC name is (4-methylsulfanyl-1-oxo-1-piperidin-1-ylbutan-2-yl)urea.
| Compound Name | (4-methylsulfanyl-1-oxo-1-piperidin-1-ylbutan-2-yl)urea |
|---|---|
| PubChem CID | 60634739 |
| Molecular Formula | C11H21N3O2S |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (4-methylsulfanyl-1-oxo-1-piperidin-1-ylbutan-2-yl)urea |
| SMILES | CSCCC(NC(N)=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C11H21N3O2S/c1-17-8-5-9(13-11(12)16)10(15)14-6-3-2-4-7-14/h9H,2-8H2,1H3,(H3,12,13,16) |
| InChIKey | PAPRXHWPEFWKJW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |