C12H22N4O4S — CID 43521348
2-[4-[2-(carbamoylamino)-4-methylsulfanylbutanoyl]piperazin-1-yl]acetic acid (PubChem CID 43521348) has the molecular formula C12H22N4O4S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-[4-[2-(carbamoylamino)-4-methylsulfanylbutanoyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(carbamoylamino)-4-methylsulfanylbutanoyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 43521348 |
| Molecular Formula | C12H22N4O4S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-[4-[2-(carbamoylamino)-4-methylsulfanylbutanoyl]piperazin-1-yl]acetic acid |
| SMILES | CSCCC(NC(N)=O)C(=O)N1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H22N4O4S/c1-21-7-2-9(14-12(13)20)11(19)16-5-3-15(4-6-16)8-10(17)18/h9H,2-8H2,1H3,(H,17,18)(H3,13,14,20) |
| InChIKey | LLZSFWYCRWRXLY-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |