C16H24N4O4S2 — CID 9262573
[(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea (PubChem CID 9262573) has the molecular formula C16H24N4O4S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9262573 |
| Molecular Formula | C16H24N4O4S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | [(2R)-1-[4-(benzenesulfonyl)piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
| SMILES | CSCC[C@@H](NC(N)=O)C(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N4O4S2/c1-25-12-7-14(18-16(17)22)15(21)19-8-10-20(11-9-19)26(23,24)13-5-3-2-4-6-13/h2-6,14H,7-12H2,1H3,(H3,17,18,22)/t14-/m1/s1 |
| InChIKey | LZUDXXLGTSTUNH-CQSZACIVSA-N |
| XLogP | 0.31 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |