C16H23FN4O4S2 — CID 9496577
[(2S)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea (PubChem CID 9496577) has the molecular formula C16H23FN4O4S2 and a molecular weight of 418.52 g/mol. Its IUPAC name is [(2S)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea.
| Compound Name | [(2S)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 9496577 |
| Molecular Formula | C16H23FN4O4S2 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | [(2S)-1-[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]urea |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN4O4S2/c1-26-11-6-14(19-16(18)23)15(22)20-7-9-21(10-8-20)27(24,25)13-4-2-12(17)3-5-13/h2-5,14H,6-11H2,1H3,(H3,18,19,23)/t14-/m0/s1 |
| InChIKey | XRBQOGZFXZIPTJ-AWEZNQCLSA-N |
| XLogP | 0.45 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |