C20H26N6O2S — CID 56537505
[4-methylsulfanyl-1-oxo-1-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]butan-2-yl]urea (PubChem CID 56537505) has the molecular formula C20H26N6O2S and a molecular weight of 414.54 g/mol. Its IUPAC name is [4-methylsulfanyl-1-oxo-1-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]butan-2-yl]urea.
| Compound Name | [4-methylsulfanyl-1-oxo-1-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]butan-2-yl]urea |
|---|---|
| PubChem CID | 56537505 |
| Molecular Formula | C20H26N6O2S |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | [4-methylsulfanyl-1-oxo-1-[4-(2-phenylpyrimidin-4-yl)piperazin-1-yl]butan-2-yl]urea |
| SMILES | CSCCC(NC(N)=O)C(=O)N1CCN(c2ccnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H26N6O2S/c1-29-14-8-16(23-20(21)28)19(27)26-12-10-25(11-13-26)17-7-9-22-18(24-17)15-5-3-2-4-6-15/h2-7,9,16H,8,10-14H2,1H3,(H3,21,23,28) |
| InChIKey | DIHZXUXLTSLYHD-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |