C13H26N2O3S2 — CID 60717358
N-[1-(azepan-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]ethanesulfonamide (PubChem CID 60717358) has the molecular formula C13H26N2O3S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[1-(azepan-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]ethanesulfonamide.
| Compound Name | N-[1-(azepan-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 60717358 |
| Molecular Formula | C13H26N2O3S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-[1-(azepan-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC(CCSC)C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C13H26N2O3S2/c1-3-20(17,18)14-12(8-11-19-2)13(16)15-9-6-4-5-7-10-15/h12,14H,3-11H2,1-2H3 |
| InChIKey | AEZGPFLTJRDEMU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |