C8H15N3O3S2 — CID 79194141
N-cyano-2-(ethylsulfonylamino)-4-methylsulfanylbutanamide (PubChem CID 79194141) has the molecular formula C8H15N3O3S2 and a molecular weight of 265.36 g/mol. Its IUPAC name is N-cyano-2-(ethylsulfonylamino)-4-methylsulfanylbutanamide.
| Compound Name | N-cyano-2-(ethylsulfonylamino)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 79194141 |
| Molecular Formula | C8H15N3O3S2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | N-cyano-2-(ethylsulfonylamino)-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)NC(CCSC)C(=O)NC#N |
| InChI | InChI=1S/C8H15N3O3S2/c1-3-16(13,14)11-7(4-5-15-2)8(12)10-6-9/h7,11H,3-5H2,1-2H3,(H,10,12) |
| InChIKey | JKDISPYXJKCBTI-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|