C14H28N2O3S2 — CID 92845467
(2S)-2-(ethylsulfonylamino)-N-(4-methylcyclohexyl)-4-methylsulfanylbutanamide (PubChem CID 92845467) has the molecular formula C14H28N2O3S2 and a molecular weight of 336.52 g/mol. Its IUPAC name is (2S)-2-(ethylsulfonylamino)-N-(4-methylcyclohexyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-(ethylsulfonylamino)-N-(4-methylcyclohexyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 92845467 |
| Molecular Formula | C14H28N2O3S2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2S)-2-(ethylsulfonylamino)-N-(4-methylcyclohexyl)-4-methylsulfanylbutanamide |
| SMILES | CCS(=O)(=O)N[C@@H](CCSC)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C14H28N2O3S2/c1-4-21(18,19)16-13(9-10-20-3)14(17)15-12-7-5-11(2)6-8-12/h11-13,16H,4-10H2,1-3H3,(H,15,17)/t11?,12?,13-/m0/s1 |
| InChIKey | KLINKEOXBYBNNH-BPCQOVAHSA-N |
| XLogP | 1.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |