C9H17NO4S2 — CID 64987474
2-(cyclopropylmethylsulfonylamino)-4-methylsulfanylbutanoic acid (PubChem CID 64987474) has the molecular formula C9H17NO4S2 and a molecular weight of 267.37 g/mol. Its IUPAC name is 2-(cyclopropylmethylsulfonylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | 2-(cyclopropylmethylsulfonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 64987474 |
| Molecular Formula | C9H17NO4S2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 2-(cyclopropylmethylsulfonylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)CC1CC1)C(=O)O |
| InChI | InChI=1S/C9H17NO4S2/c1-15-5-4-8(9(11)12)10-16(13,14)6-7-2-3-7/h7-8,10H,2-6H2,1H3,(H,11,12) |
| InChIKey | FNGMHKYTXYLQDD-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |