C9H17NO6S2 — CID 104906584
(2R)-2-[(3-methoxy-3-oxopropyl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 104906584) has the molecular formula C9H17NO6S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is (2R)-2-[(3-methoxy-3-oxopropyl)sulfonylamino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2R)-2-[(3-methoxy-3-oxopropyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 104906584 |
| Molecular Formula | C9H17NO6S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (2R)-2-[(3-methoxy-3-oxopropyl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | COC(=O)CCS(=O)(=O)N[C@H](CCSC)C(=O)O |
| InChI | InChI=1S/C9H17NO6S2/c1-16-8(11)4-6-18(14,15)10-7(9(12)13)3-5-17-2/h7,10H,3-6H2,1-2H3,(H,12,13)/t7-/m1/s1 |
| InChIKey | WEUYCQPSWGXYKS-SSDOTTSWSA-N |
| XLogP | -0.32 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |