C9H17NO7S — CID 62480752
4-methoxy-2-[(3-methoxy-3-oxopropyl)sulfonylamino]butanoic acid (PubChem CID 62480752) has the molecular formula C9H17NO7S and a molecular weight of 283.30 g/mol. Its IUPAC name is 4-methoxy-2-[(3-methoxy-3-oxopropyl)sulfonylamino]butanoic acid.
| Compound Name | 4-methoxy-2-[(3-methoxy-3-oxopropyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 62480752 |
| Molecular Formula | C9H17NO7S |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-methoxy-2-[(3-methoxy-3-oxopropyl)sulfonylamino]butanoic acid |
| SMILES | COCCC(NS(=O)(=O)CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C9H17NO7S/c1-16-5-3-7(9(12)13)10-18(14,15)6-4-8(11)17-2/h7,10H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | XKCZNORXDFUFIR-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |