C12H18N2O5S — CID 62479861
4-methoxy-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid (PubChem CID 62479861) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is 4-methoxy-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid.
| Compound Name | 4-methoxy-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 62479861 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-methoxy-2-(2-pyridin-4-ylethylsulfonylamino)butanoic acid |
| SMILES | COCCC(NS(=O)(=O)CCc1ccncc1)C(=O)O |
| InChI | InChI=1S/C12H18N2O5S/c1-19-8-4-11(12(15)16)14-20(17,18)9-5-10-2-6-13-7-3-10/h2-3,6-7,11,14H,4-5,8-9H2,1H3,(H,15,16) |
| InChIKey | MCPAFPKACRWNNX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |