About 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid
2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (PubChem CID 43361262) has the molecular formula C11H22N2O5S2
and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
Molecular Properties
| Compound Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| PubChem CID | 43361262 |
| Molecular Formula | C11H22N2O5S2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NS(=O)(=O)N1CC(C)OC(C)C1)C(=O)O |
| InChI | InChI=1S/C11H22N2O5S2/c1-8-6-13(7-9(2)18-8)20(16,17)12-10(11(14)15)4-5-19-3/h8-10,12H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | VDXXHXVOXDZBKR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid?
The IUPAC name of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid (CID 43361262) is 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid.
What is the SMILES notation for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid?
The canonical SMILES for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid is CSCCC(NS(=O)(=O)N1CC(C)OC(C)C1)C(=O)O.
What is the InChIKey of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid?
The InChIKey is VDXXHXVOXDZBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O5S2/c1-8-6-13(7-9(2)18-8)20(16,17)12-10(11(14)15)4-5-19-3/h8-10,12H,4-7H2,1-3H3,(H,14,15).
What are the key properties of 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid?
2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid has a molecular weight of 326.44 g/mol, XLogP of 0.14, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethylmorpholin-4-yl)sulfonylamino]-4-methylsulfanylbutanoic acid is sourced from PubChem (CID 43361262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).