C9H18N2O5S2 — CID 28783970
(2S)-4-methylsulfanyl-2-(morpholin-4-ylsulfonylamino)butanoic acid (PubChem CID 28783970) has the molecular formula C9H18N2O5S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S)-4-methylsulfanyl-2-(morpholin-4-ylsulfonylamino)butanoic acid.
| Compound Name | (2S)-4-methylsulfanyl-2-(morpholin-4-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 28783970 |
| Molecular Formula | C9H18N2O5S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2S)-4-methylsulfanyl-2-(morpholin-4-ylsulfonylamino)butanoic acid |
| SMILES | CSCC[C@H](NS(=O)(=O)N1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H18N2O5S2/c1-17-7-2-8(9(12)13)10-18(14,15)11-3-5-16-6-4-11/h8,10H,2-7H2,1H3,(H,12,13)/t8-/m0/s1 |
| InChIKey | ADUHNMDVTBHMNO-QMMMGPOBSA-N |
| XLogP | -0.64 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |