C10H19NO5S2 — CID 55031614
4-methylsulfanyl-2-(oxan-4-ylsulfonylamino)butanoic acid (PubChem CID 55031614) has the molecular formula C10H19NO5S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 4-methylsulfanyl-2-(oxan-4-ylsulfonylamino)butanoic acid.
| Compound Name | 4-methylsulfanyl-2-(oxan-4-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 55031614 |
| Molecular Formula | C10H19NO5S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-methylsulfanyl-2-(oxan-4-ylsulfonylamino)butanoic acid |
| SMILES | CSCCC(NS(=O)(=O)C1CCOCC1)C(=O)O |
| InChI | InChI=1S/C10H19NO5S2/c1-17-7-4-9(10(12)13)11-18(14,15)8-2-5-16-6-3-8/h8-9,11H,2-7H2,1H3,(H,12,13) |
| InChIKey | ZHAWKSOVAVJGII-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |