C9H16N2O6S — CID 62049157
4-amino-2-(oxan-4-ylsulfonylamino)-4-oxobutanoic acid (PubChem CID 62049157) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-amino-2-(oxan-4-ylsulfonylamino)-4-oxobutanoic acid.
| Compound Name | 4-amino-2-(oxan-4-ylsulfonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 62049157 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-amino-2-(oxan-4-ylsulfonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NS(=O)(=O)C1CCOCC1)C(=O)O |
| InChI | InChI=1S/C9H16N2O6S/c10-8(12)5-7(9(13)14)11-18(15,16)6-1-3-17-4-2-6/h6-7,11H,1-5H2,(H2,10,12)(H,13,14) |
| InChIKey | XRCFHIXZLAQDNS-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |