C8H13NO6S — CID 64553878
(2S)-2-(cyclopropylsulfonylamino)-4-methoxy-4-oxobutanoic acid (PubChem CID 64553878) has the molecular formula C8H13NO6S and a molecular weight of 251.26 g/mol. Its IUPAC name is (2S)-2-(cyclopropylsulfonylamino)-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-(cyclopropylsulfonylamino)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 64553878 |
| Molecular Formula | C8H13NO6S |
| Molecular Weight | 251.26 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | (2S)-2-(cyclopropylsulfonylamino)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NS(=O)(=O)C1CC1)C(=O)O |
| InChI | InChI=1S/C8H13NO6S/c1-15-7(10)4-6(8(11)12)9-16(13,14)5-2-3-5/h5-6,9H,2-4H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | ZJXMPKNQAIWGTQ-LURJTMIESA-N |
| XLogP | -0.92 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.26 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |