C9H18N2O6S — CID 63307130
(2S)-2-(diethylsulfamoylamino)-4-methoxy-4-oxobutanoic acid (PubChem CID 63307130) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-2-(diethylsulfamoylamino)-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-(diethylsulfamoylamino)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 63307130 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S)-2-(diethylsulfamoylamino)-4-methoxy-4-oxobutanoic acid |
| SMILES | CCN(CC)S(=O)(=O)N[C@@H](CC(=O)OC)C(=O)O |
| InChI | InChI=1S/C9H18N2O6S/c1-4-11(5-2)18(15,16)10-7(9(13)14)6-8(12)17-3/h7,10H,4-6H2,1-3H3,(H,13,14)/t7-/m0/s1 |
| InChIKey | COAPJZZQPTZBTM-ZETCQYMHSA-N |
| XLogP | -0.82 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |