C12H21NO6S — CID 107823923
(2S)-2-(cyclohexylsulfonylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 107823923) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is (2S)-2-(cyclohexylsulfonylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-(cyclohexylsulfonylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107823923 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2S)-2-(cyclohexylsulfonylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NS(=O)(=O)C1CCCCC1)C(=O)O |
| InChI | InChI=1S/C12H21NO6S/c1-19-11(14)8-7-10(12(15)16)13-20(17,18)9-5-3-2-4-6-9/h9-10,13H,2-8H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | SBFIYXTZSGCIDM-JTQLQIEISA-N |
| XLogP | 0.64 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |