C14H21NO5 — CID 82786592
2-(bicyclo[4.1.0]heptane-7-carbonylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 82786592) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-(bicyclo[4.1.0]heptane-7-carbonylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | 2-(bicyclo[4.1.0]heptane-7-carbonylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 82786592 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-(bicyclo[4.1.0]heptane-7-carbonylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CCC(NC(=O)C1C2CCCCC21)C(=O)O |
| InChI | InChI=1S/C14H21NO5/c1-20-11(16)7-6-10(14(18)19)15-13(17)12-8-4-2-3-5-9(8)12/h8-10,12H,2-7H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | VBGPPARKVIZIJT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |