C14H22N2O5 — CID 107824424
(2R)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 107824424) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107824424 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2R)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)C1NCC2CCCC21)C(=O)O |
| InChI | InChI=1S/C14H22N2O5/c1-21-11(17)6-5-10(14(19)20)16-13(18)12-9-4-2-3-8(9)7-15-12/h8-10,12,15H,2-7H2,1H3,(H,16,18)(H,19,20)/t8?,9?,10-,12?/m1/s1 |
| InChIKey | NOFVFCYGDIKRMK-LYZGGPHJSA-N |
| XLogP | -0.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |