C12H20N2O3 — CID 102891196
methyl (2S)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)propanoate (PubChem CID 102891196) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (2S)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)propanoate.
| Compound Name | methyl (2S)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 102891196 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl (2S)-2-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C12H20N2O3/c1-7(12(16)17-2)14-11(15)10-9-5-3-4-8(9)6-13-10/h7-10,13H,3-6H2,1-2H3,(H,14,15)/t7-,8?,9?,10?/m0/s1 |
| InChIKey | ZAUPPOLNNPERCR-KJTVYLTBSA-N |
| XLogP | 0.05 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |