C10H17N3O3 — CID 102893629
N-(2-amino-2-oxoethoxy)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide (PubChem CID 102893629) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 102893629 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxamide |
| SMILES | NC(=O)CONC(=O)C1NCC2CCCC21 |
| InChI | InChI=1S/C10H17N3O3/c11-8(14)5-16-13-10(15)9-7-3-1-2-6(7)4-12-9/h6-7,9,12H,1-5H2,(H2,11,14)(H,13,15) |
| InChIKey | QXHONCCJSLUXCZ-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|